C28H25N3O3 — CID 69213605
4-cyano-N-[4-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]benzamide (PubChem CID 69213605) has the molecular formula C28H25N3O3 and a molecular weight of 451.53 g/mol. Its IUPAC name is 4-cyano-N-[4-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]benzamide.
| Compound Name | 4-cyano-N-[4-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]benzamide |
|---|---|
| PubChem CID | 69213605 |
| Molecular Formula | C28H25N3O3 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 4-cyano-N-[4-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]benzamide |
| SMILES | COc1ccc2c(c1)C(=CC(=O)c1ccc(NC(=O)c3ccc(C#N)cc3)cc1)NC(C)(C)C2 |
| InChI | InChI=1S/C28H25N3O3/c1-28(2)16-21-10-13-23(34-3)14-24(21)25(31-28)15-26(32)19-8-11-22(12-9-19)30-27(33)20-6-4-18(17-29)5-7-20/h4-15,31H,16H2,1-3H3,(H,30,33) |
| InChIKey | XYWRYEKRLLIGEK-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|