C30H27N3O3 — CID 69211627
4-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]-N-quinolin-6-ylbenzamide (PubChem CID 69211627) has the molecular formula C30H27N3O3 and a molecular weight of 477.56 g/mol. Its IUPAC name is 4-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]-N-quinolin-6-ylbenzamide.
| Compound Name | 4-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]-N-quinolin-6-ylbenzamide |
|---|---|
| PubChem CID | 69211627 |
| Molecular Formula | C30H27N3O3 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | 4-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]-N-quinolin-6-ylbenzamide |
| SMILES | COc1ccc2c(c1)C(=CC(=O)c1ccc(C(=O)Nc3ccc4ncccc4c3)cc1)NC(C)(C)C2 |
| InChI | InChI=1S/C30H27N3O3/c1-30(2)18-22-10-12-24(36-3)16-25(22)27(33-30)17-28(34)19-6-8-20(9-7-19)29(35)32-23-11-13-26-21(15-23)5-4-14-31-26/h4-17,33H,18H2,1-3H3,(H,32,35) |
| InChIKey | GPVSQXQPEKNLAF-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|