C27H24Cl2N2O3 — CID 69214072
3,5-dichloro-N-[3-[(2Z)-2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]benzamide (PubChem CID 69214072) has the molecular formula C27H24Cl2N2O3 and a molecular weight of 495.41 g/mol. Its IUPAC name is 3,5-dichloro-N-[3-[(2Z)-2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]benzamide.
| Compound Name | 3,5-dichloro-N-[3-[(2Z)-2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]benzamide |
|---|---|
| PubChem CID | 69214072 |
| Molecular Formula | C27H24Cl2N2O3 |
| Molecular Weight | 495.41 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | 3,5-dichloro-N-[3-[(2Z)-2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]benzamide |
| SMILES | COc1ccc2c(c1)/C(=C/C(=O)c1cccc(NC(=O)c3cc(Cl)cc(Cl)c3)c1)NC(C)(C)C2 |
| InChI | InChI=1S/C27H24Cl2N2O3/c1-27(2)15-17-7-8-22(34-3)13-23(17)24(31-27)14-25(32)16-5-4-6-21(11-16)30-26(33)18-9-19(28)12-20(29)10-18/h4-14,31H,15H2,1-3H3,(H,30,33)/b24-14- |
| InChIKey | VMLQRXTWMHVWQV-OYKKKHCWSA-N |
| XLogP | 6.40 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.41 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|