C29H30N2O4 — CID 69214746
4-ethoxy-N-[3-[(2Z)-2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]benzamide (PubChem CID 69214746) has the molecular formula C29H30N2O4 and a molecular weight of 470.57 g/mol. Its IUPAC name is 4-ethoxy-N-[3-[(2Z)-2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]benzamide.
| Compound Name | 4-ethoxy-N-[3-[(2Z)-2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]benzamide |
|---|---|
| PubChem CID | 69214746 |
| Molecular Formula | C29H30N2O4 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 4-ethoxy-N-[3-[(2Z)-2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]benzamide |
| SMILES | CCOc1ccc(C(=O)Nc2cccc(C(=O)/C=C3\NC(C)(C)Cc4ccc(OC)cc43)c2)cc1 |
| InChI | InChI=1S/C29H30N2O4/c1-5-35-23-12-9-19(10-13-23)28(33)30-22-8-6-7-20(15-22)27(32)17-26-25-16-24(34-4)14-11-21(25)18-29(2,3)31-26/h6-17,31H,5,18H2,1-4H3,(H,30,33)/b26-17- |
| InChIKey | UGWVJKPGELGHKP-ONUIUJJFSA-N |
| XLogP | 5.49 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|