C28H36N2O3 — CID 69214522
N-[3-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]-2-propylpentanamide (PubChem CID 69214522) has the molecular formula C28H36N2O3 and a molecular weight of 448.61 g/mol. Its IUPAC name is N-[3-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]-2-propylpentanamide.
| Compound Name | N-[3-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]-2-propylpentanamide |
|---|---|
| PubChem CID | 69214522 |
| Molecular Formula | C28H36N2O3 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | N-[3-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]-2-propylpentanamide |
| SMILES | CCCC(CCC)C(=O)Nc1cccc(C(=O)C=C2NC(C)(C)Cc3ccc(OC)cc32)c1 |
| InChI | InChI=1S/C28H36N2O3/c1-6-9-19(10-7-2)27(32)29-22-12-8-11-20(15-22)26(31)17-25-24-16-23(33-5)14-13-21(24)18-28(3,4)30-25/h8,11-17,19,30H,6-7,9-10,18H2,1-5H3,(H,29,32) |
| InChIKey | OJTUBYYDPHAMLI-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|