C28H28N2O3 — CID 69211203
N-[3-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]-4-methylbenzamide (PubChem CID 69211203) has the molecular formula C28H28N2O3 and a molecular weight of 440.54 g/mol. Its IUPAC name is N-[3-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]-4-methylbenzamide.
| Compound Name | N-[3-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 69211203 |
| Molecular Formula | C28H28N2O3 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | N-[3-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]-4-methylbenzamide |
| SMILES | COc1ccc2c(c1)C(=CC(=O)c1cccc(NC(=O)c3ccc(C)cc3)c1)NC(C)(C)C2 |
| InChI | InChI=1S/C28H28N2O3/c1-18-8-10-19(11-9-18)27(32)29-22-7-5-6-20(14-22)26(31)16-25-24-15-23(33-4)13-12-21(24)17-28(2,3)30-25/h5-16,30H,17H2,1-4H3,(H,29,32) |
| InChIKey | FWWGTDXHAAAXNG-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|