C25H24N2O4 — CID 69209890
N-[3-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]furan-2-carboxamide (PubChem CID 69209890) has the molecular formula C25H24N2O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is N-[3-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 69209890 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | N-[3-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]furan-2-carboxamide |
| SMILES | COc1ccc2c(c1)C(=CC(=O)c1cccc(NC(=O)c3ccco3)c1)NC(C)(C)C2 |
| InChI | InChI=1S/C25H24N2O4/c1-25(2)15-17-9-10-19(30-3)13-20(17)21(27-25)14-22(28)16-6-4-7-18(12-16)26-24(29)23-8-5-11-31-23/h4-14,27H,15H2,1-3H3,(H,26,29) |
| InChIKey | UCAIDSCEQNMKAO-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|