C25H30N2O4 — CID 69214478
2-methylpropyl N-[3-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]carbamate (PubChem CID 69214478) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is 2-methylpropyl N-[3-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]carbamate.
| Compound Name | 2-methylpropyl N-[3-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]carbamate |
|---|---|
| PubChem CID | 69214478 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 2-methylpropyl N-[3-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]carbamate |
| SMILES | COc1ccc2c(c1)C(=CC(=O)c1cccc(NC(=O)OCC(C)C)c1)NC(C)(C)C2 |
| InChI | InChI=1S/C25H30N2O4/c1-16(2)15-31-24(29)26-19-8-6-7-17(11-19)23(28)13-22-21-12-20(30-5)10-9-18(21)14-25(3,4)27-22/h6-13,16,27H,14-15H2,1-5H3,(H,26,29) |
| InChIKey | SFOWRPQFEXJMOS-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|