C26H24ClN3O3 — CID 173148380
6-chloro-N-[4-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]pyridine-3-carboxamide (PubChem CID 173148380) has the molecular formula C26H24ClN3O3 and a molecular weight of 461.95 g/mol. Its IUPAC name is 6-chloro-N-[4-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[4-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 173148380 |
| Molecular Formula | C26H24ClN3O3 |
| Molecular Weight | 461.95 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | 6-chloro-N-[4-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]pyridine-3-carboxamide |
| SMILES | COc1ccc2c(c1)C(=CC(=O)c1ccc(NC(=O)c3ccc(Cl)nc3)cc1)NC(C)(C)C2 |
| InChI | InChI=1S/C26H24ClN3O3/c1-26(2)14-17-6-10-20(33-3)12-21(17)22(30-26)13-23(31)16-4-8-19(9-5-16)29-25(32)18-7-11-24(27)28-15-18/h4-13,15,30H,14H2,1-3H3,(H,29,32) |
| InChIKey | XTZLYIYSNZTAFW-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.95 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|