C32H36N2O3 — CID 69210916
N-[4-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]-4-pentylbenzamide (PubChem CID 69210916) has the molecular formula C32H36N2O3 and a molecular weight of 496.65 g/mol. Its IUPAC name is N-[4-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]-4-pentylbenzamide.
| Compound Name | N-[4-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]-4-pentylbenzamide |
|---|---|
| PubChem CID | 69210916 |
| Molecular Formula | C32H36N2O3 |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.27 |
| IUPAC Name | N-[4-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]-4-pentylbenzamide |
| SMILES | CCCCCc1ccc(C(=O)Nc2ccc(C(=O)C=C3NC(C)(C)Cc4ccc(OC)cc43)cc2)cc1 |
| InChI | InChI=1S/C32H36N2O3/c1-5-6-7-8-22-9-11-24(12-10-22)31(36)33-26-16-13-23(14-17-26)30(35)20-29-28-19-27(37-4)18-15-25(28)21-32(2,3)34-29/h9-20,34H,5-8,21H2,1-4H3,(H,33,36) |
| InChIKey | TUMVPJXYSZEPQA-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|