C27H34N2O4 — CID 69215599
hexyl N-[4-[(2Z)-2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]carbamate (PubChem CID 69215599) has the molecular formula C27H34N2O4 and a molecular weight of 450.58 g/mol. Its IUPAC name is hexyl N-[4-[(2Z)-2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]carbamate.
| Compound Name | hexyl N-[4-[(2Z)-2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]carbamate |
|---|---|
| PubChem CID | 69215599 |
| Molecular Formula | C27H34N2O4 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | hexyl N-[4-[(2Z)-2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]carbamate |
| SMILES | CCCCCCOC(=O)Nc1ccc(C(=O)/C=C2\NC(C)(C)Cc3ccc(OC)cc32)cc1 |
| InChI | InChI=1S/C27H34N2O4/c1-5-6-7-8-15-33-26(31)28-21-12-9-19(10-13-21)25(30)17-24-23-16-22(32-4)14-11-20(23)18-27(2,3)29-24/h9-14,16-17,29H,5-8,15,18H2,1-4H3,(H,28,31)/b24-17- |
| InChIKey | YTJFESGKLKRMOH-ULJHMMPZSA-N |
| XLogP | 5.97 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|