C27H32N2O3 — CID 69212486
2-cyclopentyl-N-[4-[(2Z)-2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]acetamide (PubChem CID 69212486) has the molecular formula C27H32N2O3 and a molecular weight of 432.56 g/mol. Its IUPAC name is 2-cyclopentyl-N-[4-[(2Z)-2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]acetamide.
| Compound Name | 2-cyclopentyl-N-[4-[(2Z)-2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]acetamide |
|---|---|
| PubChem CID | 69212486 |
| Molecular Formula | C27H32N2O3 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | 2-cyclopentyl-N-[4-[(2Z)-2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]acetamide |
| SMILES | COc1ccc2c(c1)/C(=C/C(=O)c1ccc(NC(=O)CC3CCCC3)cc1)NC(C)(C)C2 |
| InChI | InChI=1S/C27H32N2O3/c1-27(2)17-20-10-13-22(32-3)15-23(20)24(29-27)16-25(30)19-8-11-21(12-9-19)28-26(31)14-18-6-4-5-7-18/h8-13,15-16,18,29H,4-7,14,17H2,1-3H3,(H,28,31)/b24-16- |
| InChIKey | QKNGBHMBOBRMKD-JLPGSUDCSA-N |
| XLogP | 5.36 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|