C24H28N2O3 — CID 69211900
4-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]-N-propan-2-ylbenzamide (PubChem CID 69211900) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is 4-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]-N-propan-2-ylbenzamide.
| Compound Name | 4-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 69211900 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 4-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]-N-propan-2-ylbenzamide |
| SMILES | COc1ccc2c(c1)C(=CC(=O)c1ccc(C(=O)NC(C)C)cc1)NC(C)(C)C2 |
| InChI | InChI=1S/C24H28N2O3/c1-15(2)25-23(28)17-8-6-16(7-9-17)22(27)13-21-20-12-19(29-5)11-10-18(20)14-24(3,4)26-21/h6-13,15,26H,14H2,1-5H3,(H,25,28) |
| InChIKey | JOOKBMXYBHZOBR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|