C21H21NO4 — CID 69211939
3-[(2Z)-2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]benzoic acid (PubChem CID 69211939) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is 3-[(2Z)-2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]benzoic acid.
| Compound Name | 3-[(2Z)-2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]benzoic acid |
|---|---|
| PubChem CID | 69211939 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 3-[(2Z)-2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]benzoic acid |
| SMILES | COc1ccc2c(c1)/C(=C/C(=O)c1cccc(C(=O)O)c1)NC(C)(C)C2 |
| InChI | InChI=1S/C21H21NO4/c1-21(2)12-15-7-8-16(26-3)10-17(15)18(22-21)11-19(23)13-5-4-6-14(9-13)20(24)25/h4-11,22H,12H2,1-3H3,(H,24,25)/b18-11- |
| InChIKey | XKIVGFZIPUNLNI-WQRHYEAKSA-N |
| XLogP | 3.54 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|