C30H32N2O3 — CID 69212593
3-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]-N-methyl-N-(2-phenylethyl)benzamide (PubChem CID 69212593) has the molecular formula C30H32N2O3 and a molecular weight of 468.60 g/mol. Its IUPAC name is 3-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]-N-methyl-N-(2-phenylethyl)benzamide.
| Compound Name | 3-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]-N-methyl-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 69212593 |
| Molecular Formula | C30H32N2O3 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | 3-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]-N-methyl-N-(2-phenylethyl)benzamide |
| SMILES | COc1ccc2c(c1)C(=CC(=O)c1cccc(C(=O)N(C)CCc3ccccc3)c1)NC(C)(C)C2 |
| InChI | InChI=1S/C30H32N2O3/c1-30(2)20-24-13-14-25(35-4)18-26(24)27(31-30)19-28(33)22-11-8-12-23(17-22)29(34)32(3)16-15-21-9-6-5-7-10-21/h5-14,17-19,31H,15-16,20H2,1-4H3 |
| InChIKey | WSUHFDHQLMWYLI-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|