C26H32N2O5 — CID 69211010
N-(2,2-dimethoxyethyl)-4-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]-N-methylbenzamide (PubChem CID 69211010) has the molecular formula C26H32N2O5 and a molecular weight of 452.55 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-4-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]-N-methylbenzamide.
| Compound Name | N-(2,2-dimethoxyethyl)-4-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 69211010 |
| Molecular Formula | C26H32N2O5 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-4-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]-N-methylbenzamide |
| SMILES | COc1ccc2c(c1)C(=CC(=O)c1ccc(C(=O)N(C)CC(OC)OC)cc1)NC(C)(C)C2 |
| InChI | InChI=1S/C26H32N2O5/c1-26(2)15-19-11-12-20(31-4)13-21(19)22(27-26)14-23(29)17-7-9-18(10-8-17)25(30)28(3)16-24(32-5)33-6/h7-14,24,27H,15-16H2,1-6H3 |
| InChIKey | HZQPUIMIUNUNMT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|