C23H23F3N2O3 — CID 69212558
4-[(2Z)-2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 69212558) has the molecular formula C23H23F3N2O3 and a molecular weight of 432.44 g/mol. Its IUPAC name is 4-[(2Z)-2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-[(2Z)-2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 69212558 |
| Molecular Formula | C23H23F3N2O3 |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 4-[(2Z)-2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | COc1ccc2c(c1)/C(=C/C(=O)c1ccc(C(=O)NCC(F)(F)F)cc1)NC(C)(C)C2 |
| InChI | InChI=1S/C23H23F3N2O3/c1-22(2)12-16-8-9-17(31-3)10-18(16)19(28-22)11-20(29)14-4-6-15(7-5-14)21(30)27-13-23(24,25)26/h4-11,28H,12-13H2,1-3H3,(H,27,30)/b19-11- |
| InChIKey | BAKISWOXHWIMAY-ODLFYWEKSA-N |
| XLogP | 4.14 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|