C26H32N2O3 — CID 69213366
N-(2,2-dimethylpropyl)-4-[(2Z)-2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]benzamide (PubChem CID 69213366) has the molecular formula C26H32N2O3 and a molecular weight of 420.55 g/mol. Its IUPAC name is N-(2,2-dimethylpropyl)-4-[(2Z)-2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]benzamide.
| Compound Name | N-(2,2-dimethylpropyl)-4-[(2Z)-2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]benzamide |
|---|---|
| PubChem CID | 69213366 |
| Molecular Formula | C26H32N2O3 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | N-(2,2-dimethylpropyl)-4-[(2Z)-2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]benzamide |
| SMILES | COc1ccc2c(c1)/C(=C/C(=O)c1ccc(C(=O)NCC(C)(C)C)cc1)NC(C)(C)C2 |
| InChI | InChI=1S/C26H32N2O3/c1-25(2,3)16-27-24(30)18-9-7-17(8-10-18)23(29)14-22-21-13-20(31-6)12-11-19(21)15-26(4,5)28-22/h7-14,28H,15-16H2,1-6H3,(H,27,30)/b22-14- |
| InChIKey | XWWLLRMZGUIEFA-HMAPJEAMSA-N |
| XLogP | 4.62 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|