C28H29N3O3 — CID 69214758
4-[(2Z)-2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]-N-(2-pyridin-2-ylethyl)benzamide (PubChem CID 69214758) has the molecular formula C28H29N3O3 and a molecular weight of 455.56 g/mol. Its IUPAC name is 4-[(2Z)-2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]-N-(2-pyridin-2-ylethyl)benzamide.
| Compound Name | 4-[(2Z)-2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]-N-(2-pyridin-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 69214758 |
| Molecular Formula | C28H29N3O3 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 4-[(2Z)-2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]-N-(2-pyridin-2-ylethyl)benzamide |
| SMILES | COc1ccc2c(c1)/C(=C/C(=O)c1ccc(C(=O)NCCc3ccccn3)cc1)NC(C)(C)C2 |
| InChI | InChI=1S/C28H29N3O3/c1-28(2)18-21-11-12-23(34-3)16-24(21)25(31-28)17-26(32)19-7-9-20(10-8-19)27(33)30-15-13-22-6-4-5-14-29-22/h4-12,14,16-17,31H,13,15,18H2,1-3H3,(H,30,33)/b25-17- |
| InChIKey | VXQIPRPQPKEXPH-UQQQWYQISA-N |
| XLogP | 4.21 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|