C15H20F3NO4 — CID 15380986
tert-butyl (2R,3S)-4,4,4-trifluoro-2-hydroxy-3-(4-methoxyanilino)butanoate (PubChem CID 15380986) has the molecular formula C15H20F3NO4 and a molecular weight of 335.32 g/mol. Its IUPAC name is tert-butyl (2R,3S)-4,4,4-trifluoro-2-hydroxy-3-(4-methoxyanilino)butanoate.
| Compound Name | tert-butyl (2R,3S)-4,4,4-trifluoro-2-hydroxy-3-(4-methoxyanilino)butanoate |
|---|---|
| PubChem CID | 15380986 |
| Molecular Formula | C15H20F3NO4 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | tert-butyl (2R,3S)-4,4,4-trifluoro-2-hydroxy-3-(4-methoxyanilino)butanoate |
| SMILES | COc1ccc(N[C@@H]([C@@H](O)C(=O)OC(C)(C)C)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H20F3NO4/c1-14(2,3)23-13(21)11(20)12(15(16,17)18)19-9-5-7-10(22-4)8-6-9/h5-8,11-12,19-20H,1-4H3/t11-,12+/m1/s1 |
| InChIKey | UBXHNCWLFBLMFT-NEPJUHHUSA-N |
| XLogP | 2.74 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|