C14H18F3NO2 — CID 44543032
(2R)-2-[(1S)-2,2,2-trifluoro-1-(4-methoxyanilino)ethyl]pent-4-en-1-ol (PubChem CID 44543032) has the molecular formula C14H18F3NO2 and a molecular weight of 289.30 g/mol. Its IUPAC name is (2R)-2-[(1S)-2,2,2-trifluoro-1-(4-methoxyanilino)ethyl]pent-4-en-1-ol.
| Compound Name | (2R)-2-[(1S)-2,2,2-trifluoro-1-(4-methoxyanilino)ethyl]pent-4-en-1-ol |
|---|---|
| PubChem CID | 44543032 |
| Molecular Formula | C14H18F3NO2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | (2R)-2-[(1S)-2,2,2-trifluoro-1-(4-methoxyanilino)ethyl]pent-4-en-1-ol |
| SMILES | C=CC[C@@H](CO)[C@H](Nc1ccc(OC)cc1)C(F)(F)F |
| InChI | InChI=1S/C14H18F3NO2/c1-3-4-10(9-19)13(14(15,16)17)18-11-5-7-12(20-2)8-6-11/h3,5-8,10,13,18-19H,1,4,9H2,2H3/t10-,13-/m0/s1 |
| InChIKey | GARDZDMGLJHMPI-GWCFXTLKSA-N |
| XLogP | 3.22 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|