C20H31NO3 — CID 100942869
ethyl (3S,5R)-5-(4-methoxyanilino)-2,2,3-trimethyloct-7-enoate (PubChem CID 100942869) has the molecular formula C20H31NO3 and a molecular weight of 333.47 g/mol. Its IUPAC name is ethyl (3S,5R)-5-(4-methoxyanilino)-2,2,3-trimethyloct-7-enoate.
| Compound Name | ethyl (3S,5R)-5-(4-methoxyanilino)-2,2,3-trimethyloct-7-enoate |
|---|---|
| PubChem CID | 100942869 |
| Molecular Formula | C20H31NO3 |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | ethyl (3S,5R)-5-(4-methoxyanilino)-2,2,3-trimethyloct-7-enoate |
| SMILES | C=CC[C@H](C[C@H](C)C(C)(C)C(=O)OCC)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C20H31NO3/c1-7-9-17(21-16-10-12-18(23-6)13-11-16)14-15(3)20(4,5)19(22)24-8-2/h7,10-13,15,17,21H,1,8-9,14H2,2-6H3/t15-,17+/m0/s1 |
| InChIKey | WXNGKBNFGJQZET-DOTOQJQBSA-N |
| XLogP | 4.67 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|