C15H21NO3 — CID 24867811
ethyl (2S)-2-(4-methoxyanilino)-2-methylpent-4-enoate (PubChem CID 24867811) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is ethyl (2S)-2-(4-methoxyanilino)-2-methylpent-4-enoate.
| Compound Name | ethyl (2S)-2-(4-methoxyanilino)-2-methylpent-4-enoate |
|---|---|
| PubChem CID | 24867811 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | ethyl (2S)-2-(4-methoxyanilino)-2-methylpent-4-enoate |
| SMILES | C=CC[C@](C)(Nc1ccc(OC)cc1)C(=O)OCC |
| InChI | InChI=1S/C15H21NO3/c1-5-11-15(3,14(17)19-6-2)16-12-7-9-13(18-4)10-8-12/h5,7-10,16H,1,6,11H2,2-4H3/t15-/m0/s1 |
| InChIKey | FBGBOFWMXXETSM-HNNXBMFYSA-N |
| XLogP | 3.01 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|