C20H26O5 — CID 135079406
diethyl 2-[(E)-3-(4-methoxyphenyl)prop-2-enyl]-2-prop-2-enylpropanedioate (PubChem CID 135079406) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is diethyl 2-[(E)-3-(4-methoxyphenyl)prop-2-enyl]-2-prop-2-enylpropanedioate.
| Compound Name | diethyl 2-[(E)-3-(4-methoxyphenyl)prop-2-enyl]-2-prop-2-enylpropanedioate |
|---|---|
| PubChem CID | 135079406 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | diethyl 2-[(E)-3-(4-methoxyphenyl)prop-2-enyl]-2-prop-2-enylpropanedioate |
| SMILES | C=CCC(C/C=C/c1ccc(OC)cc1)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C20H26O5/c1-5-14-20(18(21)24-6-2,19(22)25-7-3)15-8-9-16-10-12-17(23-4)13-11-16/h5,8-13H,1,6-7,14-15H2,2-4H3/b9-8+ |
| InChIKey | KCWXHIQJOBAJCG-CMDGGOBGSA-N |
| XLogP | 3.79 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|