C40H60NO5+ — CID 102211441
6-[4-[(1E)-4,4-bis(ethoxycarbonyl)hepta-1,6-dienyl]phenoxy]hexyl-[(3,5-ditert-butylphenyl)methyl]azanium (PubChem CID 102211441) has the molecular formula C40H60NO5+ and a molecular weight of 634.92 g/mol. Its IUPAC name is 6-[4-[(1E)-4,4-bis(ethoxycarbonyl)hepta-1,6-dienyl]phenoxy]hexyl-[(3,5-ditert-butylphenyl)methyl]azanium.
| Compound Name | 6-[4-[(1E)-4,4-bis(ethoxycarbonyl)hepta-1,6-dienyl]phenoxy]hexyl-[(3,5-ditert-butylphenyl)methyl]azanium |
|---|---|
| PubChem CID | 102211441 |
| Molecular Formula | C40H60NO5+ |
| Molecular Weight | 634.92 g/mol |
| Exact Mass | 634.45 |
| IUPAC Name | 6-[4-[(1E)-4,4-bis(ethoxycarbonyl)hepta-1,6-dienyl]phenoxy]hexyl-[(3,5-ditert-butylphenyl)methyl]azanium |
| SMILES | C=CCC(C/C=C/c1ccc(OCCCCCC[NH2+]Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2)cc1)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C40H59NO5/c1-10-23-40(36(42)44-11-2,37(43)45-12-3)24-17-18-31-19-21-35(22-20-31)46-26-16-14-13-15-25-41-30-32-27-33(38(4,5)6)29-34(28-32)39(7,8)9/h10,17-22,27-29,41H,1,11-16,23-26,30H2,2-9H3/p+1/b18-17+ |
| InChIKey | ZUNMJNKHRXOKQA-ISLYRVAYSA-O |
| XLogP | 8.08 |
| TPSA | 78.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.92 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|