C40H59NO5 — CID 102211442
diethyl 2-[(E)-3-[4-[6-[(3,5-ditert-butylphenyl)methylamino]hexoxy]phenyl]prop-2-enyl]-2-prop-2-enylpropanedioate (PubChem CID 102211442) has the molecular formula C40H59NO5 and a molecular weight of 633.91 g/mol. Its IUPAC name is diethyl 2-[(E)-3-[4-[6-[(3,5-ditert-butylphenyl)methylamino]hexoxy]phenyl]prop-2-enyl]-2-prop-2-enylpropanedioate.
| Compound Name | diethyl 2-[(E)-3-[4-[6-[(3,5-ditert-butylphenyl)methylamino]hexoxy]phenyl]prop-2-enyl]-2-prop-2-enylpropanedioate |
|---|---|
| PubChem CID | 102211442 |
| Molecular Formula | C40H59NO5 |
| Molecular Weight | 633.91 g/mol |
| Exact Mass | 633.44 |
| IUPAC Name | diethyl 2-[(E)-3-[4-[6-[(3,5-ditert-butylphenyl)methylamino]hexoxy]phenyl]prop-2-enyl]-2-prop-2-enylpropanedioate |
| SMILES | C=CCC(C/C=C/c1ccc(OCCCCCCNCc2cc(C(C)(C)C)cc(C(C)(C)C)c2)cc1)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C40H59NO5/c1-10-23-40(36(42)44-11-2,37(43)45-12-3)24-17-18-31-19-21-35(22-20-31)46-26-16-14-13-15-25-41-30-32-27-33(38(4,5)6)29-34(28-32)39(7,8)9/h10,17-22,27-29,41H,1,11-16,23-26,30H2,2-9H3/b18-17+ |
| InChIKey | ZUNMJNKHRXOKQA-ISLYRVAYSA-N |
| XLogP | 9.10 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.91 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|