C21H27NO6 — CID 67562545
(Z)-4-[6-[4-[(Z)-3-ethoxy-3-oxoprop-1-enyl]phenoxy]hexylamino]-4-oxobut-2-enoic acid (PubChem CID 67562545) has the molecular formula C21H27NO6 and a molecular weight of 389.45 g/mol. Its IUPAC name is (Z)-4-[6-[4-[(Z)-3-ethoxy-3-oxoprop-1-enyl]phenoxy]hexylamino]-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[6-[4-[(Z)-3-ethoxy-3-oxoprop-1-enyl]phenoxy]hexylamino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 67562545 |
| Molecular Formula | C21H27NO6 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | (Z)-4-[6-[4-[(Z)-3-ethoxy-3-oxoprop-1-enyl]phenoxy]hexylamino]-4-oxobut-2-enoic acid |
| SMILES | CCOC(=O)/C=C\c1ccc(OCCCCCCNC(=O)/C=C\C(=O)O)cc1 |
| InChI | InChI=1S/C21H27NO6/c1-2-27-21(26)14-9-17-7-10-18(11-8-17)28-16-6-4-3-5-15-22-19(23)12-13-20(24)25/h7-14H,2-6,15-16H2,1H3,(H,22,23)(H,24,25)/b13-12-,14-9- |
| InChIKey | HASBOIUCRBYPII-ZRABRPJWSA-N |
| XLogP | 2.96 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|