C26H34O7 — CID 14180324
ethyl (E)-3-[4-[4-(2,3,4,5-tetramethoxy-6-methylphenyl)butoxy]phenyl]prop-2-enoate (PubChem CID 14180324) has the molecular formula C26H34O7 and a molecular weight of 458.55 g/mol. Its IUPAC name is ethyl (E)-3-[4-[4-(2,3,4,5-tetramethoxy-6-methylphenyl)butoxy]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[4-(2,3,4,5-tetramethoxy-6-methylphenyl)butoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 14180324 |
| Molecular Formula | C26H34O7 |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | ethyl (E)-3-[4-[4-(2,3,4,5-tetramethoxy-6-methylphenyl)butoxy]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(OCCCCc2c(C)c(OC)c(OC)c(OC)c2OC)cc1 |
| InChI | InChI=1S/C26H34O7/c1-7-32-22(27)16-13-19-11-14-20(15-12-19)33-17-9-8-10-21-18(2)23(28-3)25(30-5)26(31-6)24(21)29-4/h11-16H,7-10,17H2,1-6H3/b16-13+ |
| InChIKey | BFAJNZUEKZWOAR-DTQAZKPQSA-N |
| XLogP | 5.01 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|