C13H15NO5 — CID 82036708
(E)-4-[2-(4-methoxyphenoxy)ethylamino]-4-oxobut-2-enoic acid (PubChem CID 82036708) has the molecular formula C13H15NO5 and a molecular weight of 265.27 g/mol. Its IUPAC name is (E)-4-[2-(4-methoxyphenoxy)ethylamino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[2-(4-methoxyphenoxy)ethylamino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 82036708 |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | (E)-4-[2-(4-methoxyphenoxy)ethylamino]-4-oxobut-2-enoic acid |
| SMILES | COc1ccc(OCCNC(=O)/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C13H15NO5/c1-18-10-2-4-11(5-3-10)19-9-8-14-12(15)6-7-13(16)17/h2-7H,8-9H2,1H3,(H,14,15)(H,16,17)/b7-6+ |
| InChIKey | OCJKVBHWHSDHHK-VOTSOKGWSA-N |
| XLogP | 0.83 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|