C19H18F3NO4 — CID 46442777
(E)-N-[2-(4-methoxyphenoxy)ethyl]-3-[2-(trifluoromethoxy)phenyl]prop-2-enamide (PubChem CID 46442777) has the molecular formula C19H18F3NO4 and a molecular weight of 381.35 g/mol. Its IUPAC name is (E)-N-[2-(4-methoxyphenoxy)ethyl]-3-[2-(trifluoromethoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[2-(4-methoxyphenoxy)ethyl]-3-[2-(trifluoromethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 46442777 |
| Molecular Formula | C19H18F3NO4 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | (E)-N-[2-(4-methoxyphenoxy)ethyl]-3-[2-(trifluoromethoxy)phenyl]prop-2-enamide |
| SMILES | COc1ccc(OCCNC(=O)/C=C/c2ccccc2OC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H18F3NO4/c1-25-15-7-9-16(10-8-15)26-13-12-23-18(24)11-6-14-4-2-3-5-17(14)27-19(20,21)22/h2-11H,12-13H2,1H3,(H,23,24)/b11-6+ |
| InChIKey | ABHHKBHFAVOJND-IZZDOVSWSA-N |
| XLogP | 3.80 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|