C20H21F3O4 — CID 11315053
diethyl 2-prop-2-ynyl-2-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enyl]propanedioate (PubChem CID 11315053) has the molecular formula C20H21F3O4 and a molecular weight of 382.38 g/mol. Its IUPAC name is diethyl 2-prop-2-ynyl-2-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enyl]propanedioate.
| Compound Name | diethyl 2-prop-2-ynyl-2-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enyl]propanedioate |
|---|---|
| PubChem CID | 11315053 |
| Molecular Formula | C20H21F3O4 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | diethyl 2-prop-2-ynyl-2-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enyl]propanedioate |
| SMILES | C#CCC(C/C=C/c1ccc(C(F)(F)F)cc1)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C20H21F3O4/c1-4-13-19(17(24)26-5-2,18(25)27-6-3)14-7-8-15-9-11-16(12-10-15)20(21,22)23/h1,7-12H,5-6,13-14H2,2-3H3/b8-7+ |
| InChIKey | CFDURVFRYCETRE-BQYQJAHWSA-N |
| XLogP | 4.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|