C26H36O4 — CID 53381295
diethyl 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-[(E)-3-phenylprop-2-enyl]propanedioate (PubChem CID 53381295) has the molecular formula C26H36O4 and a molecular weight of 412.57 g/mol. Its IUPAC name is diethyl 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-[(E)-3-phenylprop-2-enyl]propanedioate.
| Compound Name | diethyl 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-[(E)-3-phenylprop-2-enyl]propanedioate |
|---|---|
| PubChem CID | 53381295 |
| Molecular Formula | C26H36O4 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | diethyl 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-[(E)-3-phenylprop-2-enyl]propanedioate |
| SMILES | CCOC(=O)C(C/C=C/c1ccccc1)(C/C=C(\C)CCC=C(C)C)C(=O)OCC |
| InChI | InChI=1S/C26H36O4/c1-6-29-24(27)26(25(28)30-7-2,19-12-17-23-15-9-8-10-16-23)20-18-22(5)14-11-13-21(3)4/h8-10,12-13,15-18H,6-7,11,14,19-20H2,1-5H3/b17-12+,22-18+ |
| InChIKey | GPDXQZAASBUUQM-SUVVCHFKSA-N |
| XLogP | 6.29 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|