About dibenzyl 2-(4-methylpenta-2,3-dienyl)-2-[(E)-3-phenylprop-2-enyl]propanedioate
dibenzyl 2-(4-methylpenta-2,3-dienyl)-2-[(E)-3-phenylprop-2-enyl]propanedioate (PubChem CID 46188652) has the molecular formula C32H32O4
and a molecular weight of 480.60 g/mol. Its IUPAC name is dibenzyl 2-(4-methylpenta-2,3-dienyl)-2-[(E)-3-phenylprop-2-enyl]propanedioate.
Molecular Properties
| Compound Name | dibenzyl 2-(4-methylpenta-2,3-dienyl)-2-[(E)-3-phenylprop-2-enyl]propanedioate |
| PubChem CID | 46188652 |
| Molecular Formula | C32H32O4 |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | dibenzyl 2-(4-methylpenta-2,3-dienyl)-2-[(E)-3-phenylprop-2-enyl]propanedioate |
| SMILES | CC(C)=C=CCC(C/C=C/c1ccccc1)(C(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H32O4/c1-26(2)14-12-22-32(23-13-21-27-15-6-3-7-16-27,30(33)35-24-28-17-8-4-9-18-28)31(34)36-25-29-19-10-5-11-20-29/h3-13,15-21H,22-25H2,1-2H3/b21-13+ |
| InChIKey | AFFJHGUYUPMRSF-FYJGNVAPSA-N |
| XLogP | 7.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze dibenzyl 2-(4-methylpenta-2,3-dienyl)-2-[(E)-3-phenylprop-2-enyl]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzyl 2-(4-methylpenta-2,3-dienyl)-2-[(E)-3-phenylprop-2-enyl]propanedioate?
The IUPAC name of dibenzyl 2-(4-methylpenta-2,3-dienyl)-2-[(E)-3-phenylprop-2-enyl]propanedioate (CID 46188652) is dibenzyl 2-(4-methylpenta-2,3-dienyl)-2-[(E)-3-phenylprop-2-enyl]propanedioate.
What is the SMILES notation for dibenzyl 2-(4-methylpenta-2,3-dienyl)-2-[(E)-3-phenylprop-2-enyl]propanedioate?
The canonical SMILES for dibenzyl 2-(4-methylpenta-2,3-dienyl)-2-[(E)-3-phenylprop-2-enyl]propanedioate is CC(C)=C=CCC(C/C=C/c1ccccc1)(C(=O)OCc1ccccc1)C(=O)OCc1ccccc1.
What is the InChIKey of dibenzyl 2-(4-methylpenta-2,3-dienyl)-2-[(E)-3-phenylprop-2-enyl]propanedioate?
The InChIKey is AFFJHGUYUPMRSF-FYJGNVAPSA-N. The full InChI is InChI=1S/C32H32O4/c1-26(2)14-12-22-32(23-13-21-27-15-6-3-7-16-27,30(33)35-24-28-17-8-4-9-18-28)31(34)36-25-29-19-10-5-11-20-29/h3-13,15-21H,22-25H2,1-2H3/b21-13+.
What are the key properties of dibenzyl 2-(4-methylpenta-2,3-dienyl)-2-[(E)-3-phenylprop-2-enyl]propanedioate?
dibenzyl 2-(4-methylpenta-2,3-dienyl)-2-[(E)-3-phenylprop-2-enyl]propanedioate has a molecular weight of 480.60 g/mol, XLogP of 7.07, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzyl 2-(4-methylpenta-2,3-dienyl)-2-[(E)-3-phenylprop-2-enyl]propanedioate is sourced from PubChem (CID 46188652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).