C34H36O8 — CID 102046698
tetramethyl (1E,6E,13E)-1,14-diphenyltetradeca-1,6,13-trien-8-yne-3,3,10,10-tetracarboxylate (PubChem CID 102046698) has the molecular formula C34H36O8 and a molecular weight of 572.65 g/mol. Its IUPAC name is tetramethyl (1E,6E,13E)-1,14-diphenyltetradeca-1,6,13-trien-8-yne-3,3,10,10-tetracarboxylate.
| Compound Name | tetramethyl (1E,6E,13E)-1,14-diphenyltetradeca-1,6,13-trien-8-yne-3,3,10,10-tetracarboxylate |
|---|---|
| PubChem CID | 102046698 |
| Molecular Formula | C34H36O8 |
| Molecular Weight | 572.65 g/mol |
| Exact Mass | 572.24 |
| IUPAC Name | tetramethyl (1E,6E,13E)-1,14-diphenyltetradeca-1,6,13-trien-8-yne-3,3,10,10-tetracarboxylate |
| SMILES | COC(=O)C(CC#C/C=C/CC(C/C=C/c1ccccc1)(C(=O)OC)C(=O)OC)(C/C=C/c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C34H36O8/c1-39-29(35)33(30(36)40-2,25-15-21-27-17-9-7-10-18-27)23-13-5-6-14-24-34(31(37)41-3,32(38)42-4)26-16-22-28-19-11-8-12-20-28/h5,7-13,15-22H,23-26H2,1-4H3/b13-5+,21-15+,22-16+ |
| InChIKey | WDMUCFXUDHTFBX-QLDKYEIGSA-N |
| XLogP | 5.20 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.65 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|