C30H42O5Si — CID 102148466
dimethyl 2-[(Z)-hex-4-en-2-ynyl]-2-[(1Z,3E)-4-phenyl-2-tri(propan-2-yl)silyloxybuta-1,3-dienyl]propanedioate (PubChem CID 102148466) has the molecular formula C30H42O5Si and a molecular weight of 510.75 g/mol. Its IUPAC name is dimethyl 2-[(Z)-hex-4-en-2-ynyl]-2-[(1Z,3E)-4-phenyl-2-tri(propan-2-yl)silyloxybuta-1,3-dienyl]propanedioate.
| Compound Name | dimethyl 2-[(Z)-hex-4-en-2-ynyl]-2-[(1Z,3E)-4-phenyl-2-tri(propan-2-yl)silyloxybuta-1,3-dienyl]propanedioate |
|---|---|
| PubChem CID | 102148466 |
| Molecular Formula | C30H42O5Si |
| Molecular Weight | 510.75 g/mol |
| Exact Mass | 510.28 |
| IUPAC Name | dimethyl 2-[(Z)-hex-4-en-2-ynyl]-2-[(1Z,3E)-4-phenyl-2-tri(propan-2-yl)silyloxybuta-1,3-dienyl]propanedioate |
| SMILES | C/C=C\C#CCC(/C=C(/C=C/c1ccccc1)O[Si](C(C)C)(C(C)C)C(C)C)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C30H42O5Si/c1-10-11-12-16-21-30(28(31)33-8,29(32)34-9)22-27(20-19-26-17-14-13-15-18-26)35-36(23(2)3,24(4)5)25(6)7/h10-11,13-15,17-20,22-25H,21H2,1-9H3/b11-10-,20-19+,27-22- |
| InChIKey | NLUNSISJPTVNCM-XHNQPDQPSA-N |
| XLogP | 7.08 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.75 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|