C29H42O5Si — CID 177438661
dimethyl 2-[(4E)-4-methyl-5-phenyl-3-tri(propan-2-yl)silyloxypenta-2,4-dienyl]-2-prop-2-ynylpropanedioate (PubChem CID 177438661) has the molecular formula C29H42O5Si and a molecular weight of 498.74 g/mol. Its IUPAC name is dimethyl 2-[(4E)-4-methyl-5-phenyl-3-tri(propan-2-yl)silyloxypenta-2,4-dienyl]-2-prop-2-ynylpropanedioate.
| Compound Name | dimethyl 2-[(4E)-4-methyl-5-phenyl-3-tri(propan-2-yl)silyloxypenta-2,4-dienyl]-2-prop-2-ynylpropanedioate |
|---|---|
| PubChem CID | 177438661 |
| Molecular Formula | C29H42O5Si |
| Molecular Weight | 498.74 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | dimethyl 2-[(4E)-4-methyl-5-phenyl-3-tri(propan-2-yl)silyloxypenta-2,4-dienyl]-2-prop-2-ynylpropanedioate |
| SMILES | C#CCC(CC=C(O[Si](C(C)C)(C(C)C)C(C)C)/C(C)=C/c1ccccc1)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C29H42O5Si/c1-11-18-29(27(30)32-9,28(31)33-10)19-17-26(24(8)20-25-15-13-12-14-16-25)34-35(21(2)3,22(4)5)23(6)7/h1,12-17,20-23H,18-19H2,2-10H3/b24-20+,26-17? |
| InChIKey | KQHVLWYAKWBFSP-CSRGNQJBSA-N |
| XLogP | 6.91 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.74 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|