C25H36O5Si — CID 135077508
dimethyl 2-[(Z)-3-[tert-butyl(dimethyl)silyl]oxy-3-phenylprop-2-enyl]-2-pent-4-ynylpropanedioate (PubChem CID 135077508) has the molecular formula C25H36O5Si and a molecular weight of 444.64 g/mol. Its IUPAC name is dimethyl 2-[(Z)-3-[tert-butyl(dimethyl)silyl]oxy-3-phenylprop-2-enyl]-2-pent-4-ynylpropanedioate.
| Compound Name | dimethyl 2-[(Z)-3-[tert-butyl(dimethyl)silyl]oxy-3-phenylprop-2-enyl]-2-pent-4-ynylpropanedioate |
|---|---|
| PubChem CID | 135077508 |
| Molecular Formula | C25H36O5Si |
| Molecular Weight | 444.64 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | dimethyl 2-[(Z)-3-[tert-butyl(dimethyl)silyl]oxy-3-phenylprop-2-enyl]-2-pent-4-ynylpropanedioate |
| SMILES | C#CCCCC(C/C=C(\O[Si](C)(C)C(C)(C)C)c1ccccc1)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C25H36O5Si/c1-9-10-14-18-25(22(26)28-5,23(27)29-6)19-17-21(20-15-12-11-13-16-20)30-31(7,8)24(2,3)4/h1,11-13,15-17H,10,14,18-19H2,2-8H3/b21-17- |
| InChIKey | WWJDDLOEEUBKMM-FXBPSFAMSA-N |
| XLogP | 5.58 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.64 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|