C20H26OSi — CID 10358065
tert-butyl-[(Z)-1,2-diphenylethenoxy]-dimethylsilane (PubChem CID 10358065) has the molecular formula C20H26OSi and a molecular weight of 310.51 g/mol. Its IUPAC name is tert-butyl-[(Z)-1,2-diphenylethenoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(Z)-1,2-diphenylethenoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10358065 |
| Molecular Formula | C20H26OSi |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | tert-butyl-[(Z)-1,2-diphenylethenoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O/C(=C\c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H26OSi/c1-20(2,3)22(4,5)21-19(18-14-10-7-11-15-18)16-17-12-8-6-9-13-17/h6-16H,1-5H3/b19-16- |
| InChIKey | LNCHQBYZCMNUNQ-MNDPQUGUSA-N |
| XLogP | 6.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|