C22H36OSi — CID 14710921
tert-butyl-[(1Z)-3,7-dimethyl-1-phenylocta-1,6-dienoxy]-dimethylsilane (PubChem CID 14710921) has the molecular formula C22H36OSi and a molecular weight of 344.62 g/mol. Its IUPAC name is tert-butyl-[(1Z)-3,7-dimethyl-1-phenylocta-1,6-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1Z)-3,7-dimethyl-1-phenylocta-1,6-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 14710921 |
| Molecular Formula | C22H36OSi |
| Molecular Weight | 344.62 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | tert-butyl-[(1Z)-3,7-dimethyl-1-phenylocta-1,6-dienoxy]-dimethylsilane |
| SMILES | CC(C)=CCCC(C)/C=C(\O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C22H36OSi/c1-18(2)13-12-14-19(3)17-21(20-15-10-9-11-16-20)23-24(7,8)22(4,5)6/h9-11,13,15-17,19H,12,14H2,1-8H3/b21-17- |
| InChIKey | PMELVKGVBQVZLT-FXBPSFAMSA-N |
| XLogP | 7.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.62 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|