C24H34O5Si — CID 101002395
diethyl 2-[(Z)-3-[tert-butyl(dimethyl)silyl]oxy-3-phenylprop-2-enyl]-2-ethynylpropanedioate (PubChem CID 101002395) has the molecular formula C24H34O5Si and a molecular weight of 430.62 g/mol. Its IUPAC name is diethyl 2-[(Z)-3-[tert-butyl(dimethyl)silyl]oxy-3-phenylprop-2-enyl]-2-ethynylpropanedioate.
| Compound Name | diethyl 2-[(Z)-3-[tert-butyl(dimethyl)silyl]oxy-3-phenylprop-2-enyl]-2-ethynylpropanedioate |
|---|---|
| PubChem CID | 101002395 |
| Molecular Formula | C24H34O5Si |
| Molecular Weight | 430.62 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | diethyl 2-[(Z)-3-[tert-butyl(dimethyl)silyl]oxy-3-phenylprop-2-enyl]-2-ethynylpropanedioate |
| SMILES | C#CC(C/C=C(\O[Si](C)(C)C(C)(C)C)c1ccccc1)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C24H34O5Si/c1-9-24(21(25)27-10-2,22(26)28-11-3)18-17-20(19-15-13-12-14-16-19)29-30(7,8)23(4,5)6/h1,12-17H,10-11,18H2,2-8H3/b20-17- |
| InChIKey | OOFUCHJXZAJIKO-JZJYNLBNSA-N |
| XLogP | 5.19 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.62 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|