C23H33NO — CID 10664833
(2E,3E,5S)-2-(diethylaminomethylidene)-5,9-dimethyl-3-phenyldeca-3,8-dienal (PubChem CID 10664833) has the molecular formula C23H33NO and a molecular weight of 339.52 g/mol. Its IUPAC name is (2E,3E,5S)-2-(diethylaminomethylidene)-5,9-dimethyl-3-phenyldeca-3,8-dienal.
| Compound Name | (2E,3E,5S)-2-(diethylaminomethylidene)-5,9-dimethyl-3-phenyldeca-3,8-dienal |
|---|---|
| PubChem CID | 10664833 |
| Molecular Formula | C23H33NO |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.26 |
| IUPAC Name | (2E,3E,5S)-2-(diethylaminomethylidene)-5,9-dimethyl-3-phenyldeca-3,8-dienal |
| SMILES | CCN(/C=C(C=O)\C(=C\[C@@H](C)CCC=C(C)C)c1ccccc1)CC |
| InChI | InChI=1S/C23H33NO/c1-6-24(7-2)17-22(18-25)23(21-14-9-8-10-15-21)16-20(5)13-11-12-19(3)4/h8-10,12,14-18,20H,6-7,11,13H2,1-5H3/b22-17-,23-16+/t20-/m0/s1 |
| InChIKey | SBPGOIQQVPJRJC-PLYWQQORSA-N |
| XLogP | 5.88 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|