C16H22O — CID 175173281
2-[(1E)-3,7-dimethylocta-1,6-dienyl]phenol (PubChem CID 175173281) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is 2-[(1E)-3,7-dimethylocta-1,6-dienyl]phenol.
| Compound Name | 2-[(1E)-3,7-dimethylocta-1,6-dienyl]phenol |
|---|---|
| PubChem CID | 175173281 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 2-[(1E)-3,7-dimethylocta-1,6-dienyl]phenol |
| SMILES | CC(C)=CCCC(C)/C=C/c1ccccc1O |
| InChI | InChI=1S/C16H22O/c1-13(2)7-6-8-14(3)11-12-15-9-4-5-10-16(15)17/h4-5,7,9-12,14,17H,6,8H2,1-3H3/b12-11+ |
| InChIKey | NRPOYNVZRBIVEP-VAWYXSNFSA-N |
| XLogP | 4.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|