C17H25N — CID 11746843
2-[(1E,3R)-3,7-dimethylocta-1,6-dienyl]-N-methylaniline (PubChem CID 11746843) has the molecular formula C17H25N and a molecular weight of 243.39 g/mol. Its IUPAC name is 2-[(1E,3R)-3,7-dimethylocta-1,6-dienyl]-N-methylaniline.
| Compound Name | 2-[(1E,3R)-3,7-dimethylocta-1,6-dienyl]-N-methylaniline |
|---|---|
| PubChem CID | 11746843 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | 2-[(1E,3R)-3,7-dimethylocta-1,6-dienyl]-N-methylaniline |
| SMILES | CNc1ccccc1/C=C/[C@H](C)CCC=C(C)C |
| InChI | InChI=1S/C17H25N/c1-14(2)8-7-9-15(3)12-13-16-10-5-6-11-17(16)18-4/h5-6,8,10-13,15,18H,7,9H2,1-4H3/b13-12+/t15-/m1/s1 |
| InChIKey | JGWOGTDQGJEDHD-RDRICISKSA-N |
| XLogP | 5.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|