C10H17Br — CID 154265835
1-bromo-3,7-dimethylocta-1,6-diene (PubChem CID 154265835) has the molecular formula C10H17Br and a molecular weight of 217.15 g/mol. Its IUPAC name is 1-bromo-3,7-dimethylocta-1,6-diene.
| Compound Name | 1-bromo-3,7-dimethylocta-1,6-diene |
|---|---|
| PubChem CID | 154265835 |
| Molecular Formula | C10H17Br |
| Molecular Weight | 217.15 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 1-bromo-3,7-dimethylocta-1,6-diene |
| SMILES | CC(C)=CCCC(C)C=CBr |
| InChI | InChI=1S/C10H17Br/c1-9(2)5-4-6-10(3)7-8-11/h5,7-8,10H,4,6H2,1-3H3 |
| InChIKey | FLMHWDCHCOMUPL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.15 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|