C19H31NO4Si — CID 102407675
methyl 2-benzamido-4-[tert-butyl(dimethyl)silyl]oxy-2-methylbutanoate (PubChem CID 102407675) has the molecular formula C19H31NO4Si and a molecular weight of 365.55 g/mol. Its IUPAC name is methyl 2-benzamido-4-[tert-butyl(dimethyl)silyl]oxy-2-methylbutanoate.
| Compound Name | methyl 2-benzamido-4-[tert-butyl(dimethyl)silyl]oxy-2-methylbutanoate |
|---|---|
| PubChem CID | 102407675 |
| Molecular Formula | C19H31NO4Si |
| Molecular Weight | 365.55 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | methyl 2-benzamido-4-[tert-butyl(dimethyl)silyl]oxy-2-methylbutanoate |
| SMILES | COC(=O)C(C)(CCO[Si](C)(C)C(C)(C)C)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H31NO4Si/c1-18(2,3)25(6,7)24-14-13-19(4,17(22)23-5)20-16(21)15-11-9-8-10-12-15/h8-12H,13-14H2,1-7H3,(H,20,21) |
| InChIKey | IUQQPYXNKFLPCH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.55 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|