C15H33O7PSi — CID 138969798
methyl 4-[tert-butyl(dimethyl)silyl]oxy-2-(dimethoxyphosphorylmethoxy)-2-methylbutanoate (PubChem CID 138969798) has the molecular formula C15H33O7PSi and a molecular weight of 384.48 g/mol. Its IUPAC name is methyl 4-[tert-butyl(dimethyl)silyl]oxy-2-(dimethoxyphosphorylmethoxy)-2-methylbutanoate.
| Compound Name | methyl 4-[tert-butyl(dimethyl)silyl]oxy-2-(dimethoxyphosphorylmethoxy)-2-methylbutanoate |
|---|---|
| PubChem CID | 138969798 |
| Molecular Formula | C15H33O7PSi |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | methyl 4-[tert-butyl(dimethyl)silyl]oxy-2-(dimethoxyphosphorylmethoxy)-2-methylbutanoate |
| SMILES | COC(=O)C(C)(CCO[Si](C)(C)C(C)(C)C)OCP(=O)(OC)OC |
| InChI | InChI=1S/C15H33O7PSi/c1-14(2,3)24(8,9)22-11-10-15(4,13(16)18-5)21-12-23(17,19-6)20-7/h10-12H2,1-9H3 |
| InChIKey | KKGXAWGWCVYKOI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|