C16H33NO3Si — CID 59249428
methyl 2-[[5-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylpentylidene]amino]acetate (PubChem CID 59249428) has the molecular formula C16H33NO3Si and a molecular weight of 315.53 g/mol. Its IUPAC name is methyl 2-[[5-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylpentylidene]amino]acetate.
| Compound Name | methyl 2-[[5-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylpentylidene]amino]acetate |
|---|---|
| PubChem CID | 59249428 |
| Molecular Formula | C16H33NO3Si |
| Molecular Weight | 315.53 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | methyl 2-[[5-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylpentylidene]amino]acetate |
| SMILES | COC(=O)C/N=C/CC(C)(C)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H33NO3Si/c1-15(2,3)21(7,8)20-12-10-16(4,5)9-11-17-13-14(18)19-6/h11H,9-10,12-13H2,1-8H3/b17-11+ |
| InChIKey | QGGSFXQMLTXQBJ-GZTJUZNOSA-N |
| XLogP | 4.06 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.53 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|