C21H39NO3Si — CID 59249624
tert-butyl 2-[2-[1-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-3-en-1-yl]ethylideneamino]acetate (PubChem CID 59249624) has the molecular formula C21H39NO3Si and a molecular weight of 381.63 g/mol. Its IUPAC name is tert-butyl 2-[2-[1-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-3-en-1-yl]ethylideneamino]acetate.
| Compound Name | tert-butyl 2-[2-[1-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-3-en-1-yl]ethylideneamino]acetate |
|---|---|
| PubChem CID | 59249624 |
| Molecular Formula | C21H39NO3Si |
| Molecular Weight | 381.63 g/mol |
| Exact Mass | 381.27 |
| IUPAC Name | tert-butyl 2-[2-[1-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-3-en-1-yl]ethylideneamino]acetate |
| SMILES | CC(C)(C)OC(=O)C/N=C/CC1(CO[Si](C)(C)C(C)(C)C)CC=CCC1 |
| InChI | InChI=1S/C21H39NO3Si/c1-19(2,3)25-18(23)16-22-15-14-21(12-10-9-11-13-21)17-24-26(7,8)20(4,5)6/h9-10,15H,11-14,16-17H2,1-8H3/b22-15+ |
| InChIKey | KOSRKUROOHXBKM-PXLXIMEGSA-N |
| XLogP | 5.54 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.63 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|