C12H21NO4 — CID 15882717
tert-butyl 2-[3-(1,3-dioxolan-2-yl)propylideneamino]acetate (PubChem CID 15882717) has the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. Its IUPAC name is tert-butyl 2-[3-(1,3-dioxolan-2-yl)propylideneamino]acetate.
| Compound Name | tert-butyl 2-[3-(1,3-dioxolan-2-yl)propylideneamino]acetate |
|---|---|
| PubChem CID | 15882717 |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | tert-butyl 2-[3-(1,3-dioxolan-2-yl)propylideneamino]acetate |
| SMILES | CC(C)(C)OC(=O)C/N=C/CCC1OCCO1 |
| InChI | InChI=1S/C12H21NO4/c1-12(2,3)17-10(14)9-13-6-4-5-11-15-7-8-16-11/h6,11H,4-5,7-9H2,1-3H3/b13-6+ |
| InChIKey | HTKZXXNZMPLYKC-AWNIVKPZSA-N |
| XLogP | 1.55 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|