C12H26O4SSi — CID 175541314
methyl [1-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]methanesulfonate (PubChem CID 175541314) has the molecular formula C12H26O4SSi and a molecular weight of 294.49 g/mol. Its IUPAC name is methyl [1-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]methanesulfonate.
| Compound Name | methyl [1-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]methanesulfonate |
|---|---|
| PubChem CID | 175541314 |
| Molecular Formula | C12H26O4SSi |
| Molecular Weight | 294.49 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | methyl [1-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]methanesulfonate |
| SMILES | COS(=O)(=O)CC1(CO[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C12H26O4SSi/c1-11(2,3)18(5,6)16-9-12(7-8-12)10-17(13,14)15-4/h7-10H2,1-6H3 |
| InChIKey | SPKQZFDYCOUFLK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.49 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|